Inorganic Salts
Filtered Search Results
Potassium tert-butoxide, pure, 1.6-1.7M (20 wt.%) solution in THF, AcroSeal™
CAS: 865-47-4 | C4H9KO | 112.21 g/mol
| Linear Formula | (CH3)3COK |
|---|---|
| Molecular Weight (g/mol) | 112.21 |
| InChI Key | LPNYRYFBWFDTMA-UHFFFAOYSA-N |
| Density | 0.9290g/mL |
| PubChem CID | 23665647 |
| Name Note | Pure, 1.7M (20 wt.%) solution in THF |
| Formula Weight | 112.21 |
| Color | Amber to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Potassium tert-butoxide |
| Grade | Pure |
| SMILES | CC(C)(C)[O-].[K+] |
| Concentration or Composition (by Analyte or Components) | 1.60 to 1.75M |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00012162 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides.<br |
| Packaging | AcroSeal™ Glass Bottle |
| Solubility Information | Solubility in water: reacts with water |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | potassium tert-butoxide,potassium tert-butanolate,potassium t-butoxide,potassium 2-methylpropan-2-olate,potassium tert-butylate,kotbu,2-methyl-2-propanol, potassium salt,tert-butoxypotassium,potassium-t-butoxide,t-buok |
| IUPAC Name | potassium;2-methylpropan-2-olate |
| Molecular Formula | C4H9KO |
| EINECS Number | 212-740-3 |
| Specific Gravity | 0.929 |
Cadmium sulfate, anhydrous, ACS, 99+%
CAS: 10124-36-4 Molecular Formula: CdO4S Molecular Weight (g/mol): 208.47 MDL Number: MFCD00010923 InChI Key: QCUOBSQYDGUHHT-UHFFFAOYSA-L Synonym: cadmium sulfate,cadmium sulphate,cadmium monosulfate,sulfuric acid, cadmium salt 1:1,cadmium sulfuricum,cadmium sulfate 1:1,cadmium sulfate, tetrahydrate,cadmium 2+ sulfate,caswell no. 136c,unii-947unf3z6o PubChem CID: 24962 ChEBI: CHEBI:50292 IUPAC Name: cadmium(2+);sulfate SMILES: [O-]S(=O)(=O)[O-].[Cd+2]
| PubChem CID | 24962 |
|---|---|
| CAS | 10124-36-4 |
| Molecular Weight (g/mol) | 208.47 |
| ChEBI | CHEBI:50292 |
| MDL Number | MFCD00010923 |
| SMILES | [O-]S(=O)(=O)[O-].[Cd+2] |
| Synonym | cadmium sulfate,cadmium sulphate,cadmium monosulfate,sulfuric acid, cadmium salt 1:1,cadmium sulfuricum,cadmium sulfate 1:1,cadmium sulfate, tetrahydrate,cadmium 2+ sulfate,caswell no. 136c,unii-947unf3z6o |
| IUPAC Name | cadmium(2+);sulfate |
| InChI Key | QCUOBSQYDGUHHT-UHFFFAOYSA-L |
| Molecular Formula | CdO4S |
Copper(I) iodide, 99.995%, (trace metal basis)
CAS: 7681-65-4 Molecular Formula: CuI Molecular Weight (g/mol): 190.45 MDL Number: MFCD00010978 Synonym: cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g
| CAS | 7681-65-4 |
|---|---|
| Molecular Weight (g/mol) | 190.45 |
| MDL Number | MFCD00010978 |
| Synonym | cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g |
| Molecular Formula | CuI |
Zinc iodide, 98+%, pure
CAS: 10139-47-6 Molecular Formula: I2Zn Molecular Weight (g/mol): 319.19 MDL Number: MFCD00011299
| CAS | 10139-47-6 |
|---|---|
| Molecular Weight (g/mol) | 319.19 |
| MDL Number | MFCD00011299 |
| Molecular Formula | I2Zn |
Calcium dihydrogen phosphate hydrate, 97%
CAS: 301524-28-7 Molecular Formula: CaH4O8P2 Molecular Weight (g/mol): 234.05 MDL Number: MFCD00010898 InChI Key: YYRMJZQKEFZXMX-UHFFFAOYSA-L Synonym: Calcium phosphate, monobasic; Calcium tetrahydrogen diphosphate IUPAC Name: calcium didihydrogen phosphate SMILES: [Ca++].OP(O)([O-])=O.OP(O)([O-])=O
| CAS | 301524-28-7 |
|---|---|
| Molecular Weight (g/mol) | 234.05 |
| MDL Number | MFCD00010898 |
| SMILES | [Ca++].OP(O)([O-])=O.OP(O)([O-])=O |
| Synonym | Calcium phosphate, monobasic; Calcium tetrahydrogen diphosphate |
| IUPAC Name | calcium didihydrogen phosphate |
| InChI Key | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| Molecular Formula | CaH4O8P2 |
Potassium dichromate, 99.5%, extra pure
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.19 MDL Number: MFCD00011367 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.19 |
| ChEBI | CHEBI:53444 |
| MDL Number | MFCD00011367 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Hexamethyldisiloxane, NMR grade, 99.7%
CAS: 107-46-0 Molecular Formula: C6H18OSi2 Molecular Weight (g/mol): 162.379 MDL Number: MFCD00008265 InChI Key: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC Name: trimethyl(trimethylsilyloxy)silane SMILES: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| CAS | 107-46-0 |
| Molecular Weight (g/mol) | 162.379 |
| ChEBI | CHEBI:78002 |
| MDL Number | MFCD00008265 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
| IUPAC Name | trimethyl(trimethylsilyloxy)silane |
| InChI Key | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
| Molecular Formula | C6H18OSi2 |
Manganese(IV) Oxide, 99%, -10 mesh
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Sodium Chloride, Cell Culture Reagent Grade, MP Biomedicals™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium bromide, ACS reagent
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Ammonium nitrate, 98%, ACS reagent, Thermo Scientific Chemicals
CAS: 6484-52-2 Molecular Formula: H4N2O3 Molecular Weight (g/mol): 80.04 MDL Number: MFCD00011425 InChI Key: DVARTQFDIMZBAA-UHFFFAOYSA-O Synonym: ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills PubChem CID: 22985 ChEBI: CHEBI:63038 SMILES: [NH4+].[O-][N+]([O-])=O
| PubChem CID | 22985 |
|---|---|
| CAS | 6484-52-2 |
| Molecular Weight (g/mol) | 80.04 |
| ChEBI | CHEBI:63038 |
| MDL Number | MFCD00011425 |
| SMILES | [NH4+].[O-][N+]([O-])=O |
| Synonym | ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills |
| InChI Key | DVARTQFDIMZBAA-UHFFFAOYSA-O |
| Molecular Formula | H4N2O3 |
Magnesium chloride hexahydrate, ACS, 99.0-102.0%
CAS: 7791-18-6 Molecular Formula: Cl2H12MgO6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
Sodium hydrogen carbonate, Puratronic™, 99.998% (metals basis)
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Titanium(IV) isopropoxide, 97+%
CAS: 546-68-9 Molecular Formula: C12H28O4Ti Molecular Weight (g/mol): 284.219 MDL Number: MFCD00008871 InChI Key: VXUYXOFXAQZZMF-UHFFFAOYSA-N Synonym: titanium tetraisopropanolate,titanium iv isopropoxide,tetraisopropyl orthotitanate,titanium isopropoxide,titanium tetraisopropylate,titanium isopropylate,ti isopropylate,tetraisopropoxytitanium iv,isopropyl orthotitanate,tetraisopropyl titanate PubChem CID: 11026 IUPAC Name: propan-2-olate;titanium(4+) SMILES: CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4]
| PubChem CID | 11026 |
|---|---|
| CAS | 546-68-9 |
| Molecular Weight (g/mol) | 284.219 |
| MDL Number | MFCD00008871 |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4] |
| Synonym | titanium tetraisopropanolate,titanium iv isopropoxide,tetraisopropyl orthotitanate,titanium isopropoxide,titanium tetraisopropylate,titanium isopropylate,ti isopropylate,tetraisopropoxytitanium iv,isopropyl orthotitanate,tetraisopropyl titanate |
| IUPAC Name | propan-2-olate;titanium(4+) |
| InChI Key | VXUYXOFXAQZZMF-UHFFFAOYSA-N |
| Molecular Formula | C12H28O4Ti |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |